C14H12ClFN2O2S — CID 17499621
N-[3-(4-chloro-2-fluoroanilino)-3-oxopropyl]thiophene-2-carboxamide (PubChem CID 17499621) has the molecular formula C14H12ClFN2O2S and a molecular weight of 326.78 g/mol. Its IUPAC name is N-[3-(4-chloro-2-fluoroanilino)-3-oxopropyl]thiophene-2-carboxamide.
| Compound Name | N-[3-(4-chloro-2-fluoroanilino)-3-oxopropyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 17499621 |
| Molecular Formula | C14H12ClFN2O2S |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | N-[3-(4-chloro-2-fluoroanilino)-3-oxopropyl]thiophene-2-carboxamide |
| SMILES | O=C(CCNC(=O)c1cccs1)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C14H12ClFN2O2S/c15-9-3-4-11(10(16)8-9)18-13(19)5-6-17-14(20)12-2-1-7-21-12/h1-4,7-8H,5-6H2,(H,17,20)(H,18,19) |
| InChIKey | NODWUMGHVCPMCW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |