C16H17ClN2O4S — CID 17499997
N-[3-(5-chloro-2,4-dimethoxyanilino)-3-oxopropyl]thiophene-2-carboxamide (PubChem CID 17499997) has the molecular formula C16H17ClN2O4S and a molecular weight of 368.84 g/mol. Its IUPAC name is N-[3-(5-chloro-2,4-dimethoxyanilino)-3-oxopropyl]thiophene-2-carboxamide.
| Compound Name | N-[3-(5-chloro-2,4-dimethoxyanilino)-3-oxopropyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 17499997 |
| Molecular Formula | C16H17ClN2O4S |
| Molecular Weight | 368.84 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | N-[3-(5-chloro-2,4-dimethoxyanilino)-3-oxopropyl]thiophene-2-carboxamide |
| SMILES | COc1cc(OC)c(NC(=O)CCNC(=O)c2cccs2)cc1Cl |
| InChI | InChI=1S/C16H17ClN2O4S/c1-22-12-9-13(23-2)11(8-10(12)17)19-15(20)5-6-18-16(21)14-4-3-7-24-14/h3-4,7-9H,5-6H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | RNQLZPRSSBLVKP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.84 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |