C15H15ClN2O3S — CID 17497310
N-[3-(3-chloro-4-methoxyanilino)-3-oxopropyl]thiophene-2-carboxamide (PubChem CID 17497310) has the molecular formula C15H15ClN2O3S and a molecular weight of 338.82 g/mol. Its IUPAC name is N-[3-(3-chloro-4-methoxyanilino)-3-oxopropyl]thiophene-2-carboxamide.
| Compound Name | N-[3-(3-chloro-4-methoxyanilino)-3-oxopropyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 17497310 |
| Molecular Formula | C15H15ClN2O3S |
| Molecular Weight | 338.82 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | N-[3-(3-chloro-4-methoxyanilino)-3-oxopropyl]thiophene-2-carboxamide |
| SMILES | COc1ccc(NC(=O)CCNC(=O)c2cccs2)cc1Cl |
| InChI | InChI=1S/C15H15ClN2O3S/c1-21-12-5-4-10(9-11(12)16)18-14(19)6-7-17-15(20)13-3-2-8-22-13/h2-5,8-9H,6-7H2,1H3,(H,17,20)(H,18,19) |
| InChIKey | DQCPUUXJPDRJRM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.82 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |