C13H11ClN2O3S — CID 110866426
N-[(3-chloro-4-methoxyphenyl)carbamoyl]thiophene-2-carboxamide (PubChem CID 110866426) has the molecular formula C13H11ClN2O3S and a molecular weight of 310.76 g/mol. Its IUPAC name is N-[(3-chloro-4-methoxyphenyl)carbamoyl]thiophene-2-carboxamide.
| Compound Name | N-[(3-chloro-4-methoxyphenyl)carbamoyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 110866426 |
| Molecular Formula | C13H11ClN2O3S |
| Molecular Weight | 310.76 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | N-[(3-chloro-4-methoxyphenyl)carbamoyl]thiophene-2-carboxamide |
| SMILES | COc1ccc(NC(=O)NC(=O)c2cccs2)cc1Cl |
| InChI | InChI=1S/C13H11ClN2O3S/c1-19-10-5-4-8(7-9(10)14)15-13(18)16-12(17)11-3-2-6-20-11/h2-7H,1H3,(H2,15,16,17,18) |
| InChIKey | ZJSFJRUFSLMELN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.76 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |