C16H17ClN2O3S — CID 51895048
N-(3-chloro-4-methoxyphenyl)-N'-[(2R)-1-thiophen-2-ylpropan-2-yl]oxamide (PubChem CID 51895048) has the molecular formula C16H17ClN2O3S and a molecular weight of 352.84 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-N'-[(2R)-1-thiophen-2-ylpropan-2-yl]oxamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-N'-[(2R)-1-thiophen-2-ylpropan-2-yl]oxamide |
|---|---|
| PubChem CID | 51895048 |
| Molecular Formula | C16H17ClN2O3S |
| Molecular Weight | 352.84 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-N'-[(2R)-1-thiophen-2-ylpropan-2-yl]oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)N[C@H](C)Cc2cccs2)cc1Cl |
| InChI | InChI=1S/C16H17ClN2O3S/c1-10(8-12-4-3-7-23-12)18-15(20)16(21)19-11-5-6-14(22-2)13(17)9-11/h3-7,9-10H,8H2,1-2H3,(H,18,20)(H,19,21)/t10-/m1/s1 |
| InChIKey | MTGPCWDUEJKCOJ-SNVBAGLBSA-N |
| XLogP | 3.10 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.84 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|