C16H14ClN3O4 — CID 108501263
N-(4-carbamoylphenyl)-N'-(3-chloro-4-methoxyphenyl)oxamide (PubChem CID 108501263) has the molecular formula C16H14ClN3O4 and a molecular weight of 347.76 g/mol. Its IUPAC name is N-(4-carbamoylphenyl)-N'-(3-chloro-4-methoxyphenyl)oxamide.
| Compound Name | N-(4-carbamoylphenyl)-N'-(3-chloro-4-methoxyphenyl)oxamide |
|---|---|
| PubChem CID | 108501263 |
| Molecular Formula | C16H14ClN3O4 |
| Molecular Weight | 347.76 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | N-(4-carbamoylphenyl)-N'-(3-chloro-4-methoxyphenyl)oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)Nc2ccc(C(N)=O)cc2)cc1Cl |
| InChI | InChI=1S/C16H14ClN3O4/c1-24-13-7-6-11(8-12(13)17)20-16(23)15(22)19-10-4-2-9(3-5-10)14(18)21/h2-8H,1H3,(H2,18,21)(H,19,22)(H,20,23) |
| InChIKey | AUVNCJCBOXDUMQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.76 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|