C16H15Cl2N3O3S — CID 87563540
N-[(4-carbamoylphenyl)carbamothioyl]-3-chloro-4-methoxybenzamide;hydrochloride (PubChem CID 87563540) has the molecular formula C16H15Cl2N3O3S and a molecular weight of 400.29 g/mol. Its IUPAC name is N-[(4-carbamoylphenyl)carbamothioyl]-3-chloro-4-methoxybenzamide;hydrochloride.
| Compound Name | N-[(4-carbamoylphenyl)carbamothioyl]-3-chloro-4-methoxybenzamide;hydrochloride |
|---|---|
| PubChem CID | 87563540 |
| Molecular Formula | C16H15Cl2N3O3S |
| Molecular Weight | 400.29 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | N-[(4-carbamoylphenyl)carbamothioyl]-3-chloro-4-methoxybenzamide;hydrochloride |
| SMILES | COc1ccc(C(=O)NC(=S)Nc2ccc(C(N)=O)cc2)cc1Cl.Cl |
| InChI | InChI=1S/C16H14ClN3O3S.ClH/c1-23-13-7-4-10(8-12(13)17)15(22)20-16(24)19-11-5-2-9(3-6-11)14(18)21;/h2-8H,1H3,(H2,18,21)(H2,19,20,22,24);1H |
| InChIKey | WPMXAUVQWTVCQO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|