C19H19ClN2O4S — CID 2278731
propyl 4-[(3-chloro-4-methoxybenzoyl)carbamothioylamino]benzoate (PubChem CID 2278731) has the molecular formula C19H19ClN2O4S and a molecular weight of 406.89 g/mol. Its IUPAC name is propyl 4-[(3-chloro-4-methoxybenzoyl)carbamothioylamino]benzoate.
| Compound Name | propyl 4-[(3-chloro-4-methoxybenzoyl)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 2278731 |
| Molecular Formula | C19H19ClN2O4S |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | propyl 4-[(3-chloro-4-methoxybenzoyl)carbamothioylamino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NC(=S)NC(=O)c2ccc(OC)c(Cl)c2)cc1 |
| InChI | InChI=1S/C19H19ClN2O4S/c1-3-10-26-18(24)12-4-7-14(8-5-12)21-19(27)22-17(23)13-6-9-16(25-2)15(20)11-13/h4-9,11H,3,10H2,1-2H3,(H2,21,22,23,27) |
| InChIKey | RDSBPLKPVGILIE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|