C22H19ClN2O3S — CID 22778583
propyl 4-[(5-chloronaphthalene-1-carbonyl)carbamothioylamino]benzoate (PubChem CID 22778583) has the molecular formula C22H19ClN2O3S and a molecular weight of 426.93 g/mol. Its IUPAC name is propyl 4-[(5-chloronaphthalene-1-carbonyl)carbamothioylamino]benzoate.
| Compound Name | propyl 4-[(5-chloronaphthalene-1-carbonyl)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 22778583 |
| Molecular Formula | C22H19ClN2O3S |
| Molecular Weight | 426.93 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | propyl 4-[(5-chloronaphthalene-1-carbonyl)carbamothioylamino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NC(=S)NC(=O)c2cccc3c(Cl)cccc23)cc1 |
| InChI | InChI=1S/C22H19ClN2O3S/c1-2-13-28-21(27)14-9-11-15(12-10-14)24-22(29)25-20(26)18-7-3-6-17-16(18)5-4-8-19(17)23/h3-12H,2,13H2,1H3,(H2,24,25,26,29) |
| InChIKey | QIWFAVVZZPBHPK-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.93 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|