C20H21ClN2O3S — CID 17179261
propyl 4-[3-(2-chlorophenyl)propanoylcarbamothioylamino]benzoate (PubChem CID 17179261) has the molecular formula C20H21ClN2O3S and a molecular weight of 404.92 g/mol. Its IUPAC name is propyl 4-[3-(2-chlorophenyl)propanoylcarbamothioylamino]benzoate.
| Compound Name | propyl 4-[3-(2-chlorophenyl)propanoylcarbamothioylamino]benzoate |
|---|---|
| PubChem CID | 17179261 |
| Molecular Formula | C20H21ClN2O3S |
| Molecular Weight | 404.92 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | propyl 4-[3-(2-chlorophenyl)propanoylcarbamothioylamino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NC(=S)NC(=O)CCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C20H21ClN2O3S/c1-2-13-26-19(25)15-7-10-16(11-8-15)22-20(27)23-18(24)12-9-14-5-3-4-6-17(14)21/h3-8,10-11H,2,9,12-13H2,1H3,(H2,22,23,24,27) |
| InChIKey | QMMCJONRSCREEY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.92 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|