C22H27ClN2O2S — CID 17179421
3-(2-chlorophenyl)-N-[(3-hexoxyphenyl)carbamothioyl]propanamide (PubChem CID 17179421) has the molecular formula C22H27ClN2O2S and a molecular weight of 418.99 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-[(3-hexoxyphenyl)carbamothioyl]propanamide.
| Compound Name | 3-(2-chlorophenyl)-N-[(3-hexoxyphenyl)carbamothioyl]propanamide |
|---|---|
| PubChem CID | 17179421 |
| Molecular Formula | C22H27ClN2O2S |
| Molecular Weight | 418.99 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 3-(2-chlorophenyl)-N-[(3-hexoxyphenyl)carbamothioyl]propanamide |
| SMILES | CCCCCCOc1cccc(NC(=S)NC(=O)CCc2ccccc2Cl)c1 |
| InChI | InChI=1S/C22H27ClN2O2S/c1-2-3-4-7-15-27-19-11-8-10-18(16-19)24-22(28)25-21(26)14-13-17-9-5-6-12-20(17)23/h5-6,8-12,16H,2-4,7,13-15H2,1H3,(H2,24,25,26,28) |
| InChIKey | SYAVYGGUMJTKPI-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.99 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|