C25H25ClN2O2S — CID 17179432
3-(2-chlorophenyl)-N-[[4-(3-phenylpropoxy)phenyl]carbamothioyl]propanamide (PubChem CID 17179432) has the molecular formula C25H25ClN2O2S and a molecular weight of 453.01 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-[[4-(3-phenylpropoxy)phenyl]carbamothioyl]propanamide.
| Compound Name | 3-(2-chlorophenyl)-N-[[4-(3-phenylpropoxy)phenyl]carbamothioyl]propanamide |
|---|---|
| PubChem CID | 17179432 |
| Molecular Formula | C25H25ClN2O2S |
| Molecular Weight | 453.01 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 3-(2-chlorophenyl)-N-[[4-(3-phenylpropoxy)phenyl]carbamothioyl]propanamide |
| SMILES | O=C(CCc1ccccc1Cl)NC(=S)Nc1ccc(OCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H25ClN2O2S/c26-23-11-5-4-10-20(23)12-17-24(29)28-25(31)27-21-13-15-22(16-14-21)30-18-6-9-19-7-2-1-3-8-19/h1-5,7-8,10-11,13-16H,6,9,12,17-18H2,(H2,27,28,29,31) |
| InChIKey | DLRGSAMCXCAWNJ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.01 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|