C21H24Cl2N2O3S — CID 17095167
N-[(3-butoxyphenyl)carbamothioyl]-4-(2,4-dichlorophenoxy)butanamide (PubChem CID 17095167) has the molecular formula C21H24Cl2N2O3S and a molecular weight of 455.41 g/mol. Its IUPAC name is N-[(3-butoxyphenyl)carbamothioyl]-4-(2,4-dichlorophenoxy)butanamide.
| Compound Name | N-[(3-butoxyphenyl)carbamothioyl]-4-(2,4-dichlorophenoxy)butanamide |
|---|---|
| PubChem CID | 17095167 |
| Molecular Formula | C21H24Cl2N2O3S |
| Molecular Weight | 455.41 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | N-[(3-butoxyphenyl)carbamothioyl]-4-(2,4-dichlorophenoxy)butanamide |
| SMILES | CCCCOc1cccc(NC(=S)NC(=O)CCCOc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C21H24Cl2N2O3S/c1-2-3-11-27-17-7-4-6-16(14-17)24-21(29)25-20(26)8-5-12-28-19-10-9-15(22)13-18(19)23/h4,6-7,9-10,13-14H,2-3,5,8,11-12H2,1H3,(H2,24,25,26,29) |
| InChIKey | DIIBGXZIHFBPHO-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.41 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|