C18H17Cl2NO4 — CID 17341804
[3-[4-(2,4-dichlorophenoxy)butanoylamino]phenyl] acetate (PubChem CID 17341804) has the molecular formula C18H17Cl2NO4 and a molecular weight of 382.24 g/mol. Its IUPAC name is [3-[4-(2,4-dichlorophenoxy)butanoylamino]phenyl] acetate.
| Compound Name | [3-[4-(2,4-dichlorophenoxy)butanoylamino]phenyl] acetate |
|---|---|
| PubChem CID | 17341804 |
| Molecular Formula | C18H17Cl2NO4 |
| Molecular Weight | 382.24 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | [3-[4-(2,4-dichlorophenoxy)butanoylamino]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(NC(=O)CCCOc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C18H17Cl2NO4/c1-12(22)25-15-5-2-4-14(11-15)21-18(23)6-3-9-24-17-8-7-13(19)10-16(17)20/h2,4-5,7-8,10-11H,3,6,9H2,1H3,(H,21,23) |
| InChIKey | LKBSEOAGULZVQQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.24 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|