C20H17Cl2NO2 — CID 2177409
4-(2,4-dichlorophenoxy)-N-naphthalen-1-ylbutanamide (PubChem CID 2177409) has the molecular formula C20H17Cl2NO2 and a molecular weight of 374.27 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-naphthalen-1-ylbutanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-naphthalen-1-ylbutanamide |
|---|---|
| PubChem CID | 2177409 |
| Molecular Formula | C20H17Cl2NO2 |
| Molecular Weight | 374.27 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-naphthalen-1-ylbutanamide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C20H17Cl2NO2/c21-15-10-11-19(17(22)13-15)25-12-4-9-20(24)23-18-8-3-6-14-5-1-2-7-16(14)18/h1-3,5-8,10-11,13H,4,9,12H2,(H,23,24) |
| InChIKey | BUIRYWHVSALVPQ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.27 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|