C16H13Cl3FNO2 — CID 2165687
N-(4-chloro-2-fluorophenyl)-4-(2,4-dichlorophenoxy)butanamide (PubChem CID 2165687) has the molecular formula C16H13Cl3FNO2 and a molecular weight of 376.64 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-4-(2,4-dichlorophenoxy)butanamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-4-(2,4-dichlorophenoxy)butanamide |
|---|---|
| PubChem CID | 2165687 |
| Molecular Formula | C16H13Cl3FNO2 |
| Molecular Weight | 376.64 g/mol |
| Exact Mass | 375.00 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-4-(2,4-dichlorophenoxy)butanamide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C16H13Cl3FNO2/c17-10-4-6-15(12(19)8-10)23-7-1-2-16(22)21-14-5-3-11(18)9-13(14)20/h3-6,8-9H,1-2,7H2,(H,21,22) |
| InChIKey | YFOPSMIXPITNNB-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.64 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|