C17H16Cl2N2O4 — CID 2843072
4-(2,4-dichlorophenoxy)-N-(2-methyl-4-nitrophenyl)butanamide (PubChem CID 2843072) has the molecular formula C17H16Cl2N2O4 and a molecular weight of 383.23 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-(2-methyl-4-nitrophenyl)butanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-(2-methyl-4-nitrophenyl)butanamide |
|---|---|
| PubChem CID | 2843072 |
| Molecular Formula | C17H16Cl2N2O4 |
| Molecular Weight | 383.23 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-(2-methyl-4-nitrophenyl)butanamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H16Cl2N2O4/c1-11-9-13(21(23)24)5-6-15(11)20-17(22)3-2-8-25-16-7-4-12(18)10-14(16)19/h4-7,9-10H,2-3,8H2,1H3,(H,20,22) |
| InChIKey | XADZGYWKRLFBHO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.23 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|