C17H18ClN3O3 — CID 36664825
N-(4-chloro-2-methylphenyl)-4-(4-nitroanilino)butanamide (PubChem CID 36664825) has the molecular formula C17H18ClN3O3 and a molecular weight of 347.80 g/mol. Its IUPAC name is N-(4-chloro-2-methylphenyl)-4-(4-nitroanilino)butanamide.
| Compound Name | N-(4-chloro-2-methylphenyl)-4-(4-nitroanilino)butanamide |
|---|---|
| PubChem CID | 36664825 |
| Molecular Formula | C17H18ClN3O3 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | N-(4-chloro-2-methylphenyl)-4-(4-nitroanilino)butanamide |
| SMILES | Cc1cc(Cl)ccc1NC(=O)CCCNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H18ClN3O3/c1-12-11-13(18)4-9-16(12)20-17(22)3-2-10-19-14-5-7-15(8-6-14)21(23)24/h4-9,11,19H,2-3,10H2,1H3,(H,20,22) |
| InChIKey | DSIFXTBITXCOLS-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|