C16H17N3O3 — CID 9082075
N-(2,4-dimethylphenyl)-2-(4-nitroanilino)acetamide (PubChem CID 9082075) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-(4-nitroanilino)acetamide.
| Compound Name | N-(2,4-dimethylphenyl)-2-(4-nitroanilino)acetamide |
|---|---|
| PubChem CID | 9082075 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-(4-nitroanilino)acetamide |
| SMILES | Cc1ccc(NC(=O)CNc2ccc([N+](=O)[O-])cc2)c(C)c1 |
| InChI | InChI=1S/C16H17N3O3/c1-11-3-8-15(12(2)9-11)18-16(20)10-17-13-4-6-14(7-5-13)19(21)22/h3-9,17H,10H2,1-2H3,(H,18,20) |
| InChIKey | RMGDUMADWIFZFK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|