C16H16BrN3O3 — CID 29199698
N-(3-bromophenyl)-4-(4-nitroanilino)butanamide (PubChem CID 29199698) has the molecular formula C16H16BrN3O3 and a molecular weight of 378.23 g/mol. Its IUPAC name is N-(3-bromophenyl)-4-(4-nitroanilino)butanamide.
| Compound Name | N-(3-bromophenyl)-4-(4-nitroanilino)butanamide |
|---|---|
| PubChem CID | 29199698 |
| Molecular Formula | C16H16BrN3O3 |
| Molecular Weight | 378.23 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | N-(3-bromophenyl)-4-(4-nitroanilino)butanamide |
| SMILES | O=C(CCCNc1ccc([N+](=O)[O-])cc1)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C16H16BrN3O3/c17-12-3-1-4-14(11-12)19-16(21)5-2-10-18-13-6-8-15(9-7-13)20(22)23/h1,3-4,6-9,11,18H,2,5,10H2,(H,19,21) |
| InChIKey | PCOIWWDWMZVCLI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.23 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|