C17H15BrN4O5 — CID 135420190
N-(3-bromophenyl)-N'-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]butanediamide (PubChem CID 135420190) has the molecular formula C17H15BrN4O5 and a molecular weight of 435.23 g/mol. Its IUPAC name is N-(3-bromophenyl)-N'-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]butanediamide.
| Compound Name | N-(3-bromophenyl)-N'-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]butanediamide |
|---|---|
| PubChem CID | 135420190 |
| Molecular Formula | C17H15BrN4O5 |
| Molecular Weight | 435.23 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | N-(3-bromophenyl)-N'-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]butanediamide |
| SMILES | O=C(CCC(=O)Nc1cccc(Br)c1)N/N=C/c1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C17H15BrN4O5/c18-12-2-1-3-13(9-12)20-16(24)6-7-17(25)21-19-10-11-8-14(22(26)27)4-5-15(11)23/h1-5,8-10,23H,6-7H2,(H,20,24)(H,21,25)/b19-10+ |
| InChIKey | HATIXLAUWNRAJZ-VXLYETTFSA-N |
| XLogP | 2.93 |
| TPSA | 133.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.23 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|