C18H18N4O5 — CID 4029850
N'-[(2-hydroxy-5-nitrophenyl)methylideneamino]-N-(3-methylphenyl)butanediamide (PubChem CID 4029850) has the molecular formula C18H18N4O5 and a molecular weight of 370.37 g/mol. Its IUPAC name is N'-[(2-hydroxy-5-nitrophenyl)methylideneamino]-N-(3-methylphenyl)butanediamide.
| Compound Name | N'-[(2-hydroxy-5-nitrophenyl)methylideneamino]-N-(3-methylphenyl)butanediamide |
|---|---|
| PubChem CID | 4029850 |
| Molecular Formula | C18H18N4O5 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | N'-[(2-hydroxy-5-nitrophenyl)methylideneamino]-N-(3-methylphenyl)butanediamide |
| SMILES | Cc1cccc(NC(=O)CCC(=O)NN=Cc2cc([N+](=O)[O-])ccc2O)c1 |
| InChI | InChI=1S/C18H18N4O5/c1-12-3-2-4-14(9-12)20-17(24)7-8-18(25)21-19-11-13-10-15(22(26)27)5-6-16(13)23/h2-6,9-11,23H,7-8H2,1H3,(H,20,24)(H,21,25) |
| InChIKey | MIRUIMTXOBSBNQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 133.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|