C17H18N4O4 — CID 4630446
2-(2,4-dimethylanilino)-N-[(2-hydroxy-5-nitrophenyl)methylideneamino]acetamide (PubChem CID 4630446) has the molecular formula C17H18N4O4 and a molecular weight of 342.36 g/mol. Its IUPAC name is 2-(2,4-dimethylanilino)-N-[(2-hydroxy-5-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-(2,4-dimethylanilino)-N-[(2-hydroxy-5-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 4630446 |
| Molecular Formula | C17H18N4O4 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 2-(2,4-dimethylanilino)-N-[(2-hydroxy-5-nitrophenyl)methylideneamino]acetamide |
| SMILES | Cc1ccc(NCC(=O)NN=Cc2cc([N+](=O)[O-])ccc2O)c(C)c1 |
| InChI | InChI=1S/C17H18N4O4/c1-11-3-5-15(12(2)7-11)18-10-17(23)20-19-9-13-8-14(21(24)25)4-6-16(13)22/h3-9,18,22H,10H2,1-2H3,(H,20,23) |
| InChIKey | ZYHPTMNWRUWQGD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 116.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|