C15H11Br3N4O4 — CID 4579074
N-[(2-hydroxy-5-nitrophenyl)methylideneamino]-2-(2,4,6-tribromoanilino)acetamide (PubChem CID 4579074) has the molecular formula C15H11Br3N4O4 and a molecular weight of 550.99 g/mol. Its IUPAC name is N-[(2-hydroxy-5-nitrophenyl)methylideneamino]-2-(2,4,6-tribromoanilino)acetamide.
| Compound Name | N-[(2-hydroxy-5-nitrophenyl)methylideneamino]-2-(2,4,6-tribromoanilino)acetamide |
|---|---|
| PubChem CID | 4579074 |
| Molecular Formula | C15H11Br3N4O4 |
| Molecular Weight | 550.99 g/mol |
| Exact Mass | 547.83 |
| IUPAC Name | N-[(2-hydroxy-5-nitrophenyl)methylideneamino]-2-(2,4,6-tribromoanilino)acetamide |
| SMILES | O=C(CNc1c(Br)cc(Br)cc1Br)NN=Cc1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C15H11Br3N4O4/c16-9-4-11(17)15(12(18)5-9)19-7-14(24)21-20-6-8-3-10(22(25)26)1-2-13(8)23/h1-6,19,23H,7H2,(H,21,24) |
| InChIKey | HLWSZFPYTGQBMD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 116.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.99 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|