C15H12BrN3O5 — CID 4216136
2-(3-bromophenoxy)-N-[(2-hydroxy-5-nitrophenyl)methylideneamino]acetamide (PubChem CID 4216136) has the molecular formula C15H12BrN3O5 and a molecular weight of 394.18 g/mol. Its IUPAC name is 2-(3-bromophenoxy)-N-[(2-hydroxy-5-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-(3-bromophenoxy)-N-[(2-hydroxy-5-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 4216136 |
| Molecular Formula | C15H12BrN3O5 |
| Molecular Weight | 394.18 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | 2-(3-bromophenoxy)-N-[(2-hydroxy-5-nitrophenyl)methylideneamino]acetamide |
| SMILES | O=C(COc1cccc(Br)c1)NN=Cc1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C15H12BrN3O5/c16-11-2-1-3-13(7-11)24-9-15(21)18-17-8-10-6-12(19(22)23)4-5-14(10)20/h1-8,20H,9H2,(H,18,21) |
| InChIKey | PBCPQUIGNUOUHG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.18 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|