C10H8N4O4 — CID 135715830
2-cyano-N-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]acetamide (PubChem CID 135715830) has the molecular formula C10H8N4O4 and a molecular weight of 248.20 g/mol. Its IUPAC name is 2-cyano-N-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-cyano-N-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135715830 |
| Molecular Formula | C10H8N4O4 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 2-cyano-N-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]acetamide |
| SMILES | N#CCC(=O)N/N=C/c1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C10H8N4O4/c11-4-3-10(16)13-12-6-7-5-8(14(17)18)1-2-9(7)15/h1-2,5-6,15H,3H2,(H,13,16)/b12-6+ |
| InChIKey | NFPZIUCOXLFUHO-WUXMJOGZSA-N |
| XLogP | 0.66 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|