C15H12BrN3O4 — CID 135627954
N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2-(4-nitrophenyl)acetamide (PubChem CID 135627954) has the molecular formula C15H12BrN3O4 and a molecular weight of 378.18 g/mol. Its IUPAC name is N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2-(4-nitrophenyl)acetamide.
| Compound Name | N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 135627954 |
| Molecular Formula | C15H12BrN3O4 |
| Molecular Weight | 378.18 g/mol |
| Exact Mass | 377.00 |
| IUPAC Name | N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2-(4-nitrophenyl)acetamide |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)N/N=C/c1cc(Br)ccc1O |
| InChI | InChI=1S/C15H12BrN3O4/c16-12-3-6-14(20)11(8-12)9-17-18-15(21)7-10-1-4-13(5-2-10)19(22)23/h1-6,8-9,20H,7H2,(H,18,21)/b17-9+ |
| InChIKey | USOWMYFBONXEAX-RQZCQDPDSA-N |
| XLogP | 2.76 |
| TPSA | 104.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.18 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|