C15H12BrIN2O2 — CID 135579434
2-(4-bromophenyl)-N-[(E)-(2-hydroxy-5-iodophenyl)methylideneamino]acetamide (PubChem CID 135579434) has the molecular formula C15H12BrIN2O2 and a molecular weight of 459.08 g/mol. Its IUPAC name is 2-(4-bromophenyl)-N-[(E)-(2-hydroxy-5-iodophenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-bromophenyl)-N-[(E)-(2-hydroxy-5-iodophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135579434 |
| Molecular Formula | C15H12BrIN2O2 |
| Molecular Weight | 459.08 g/mol |
| Exact Mass | 457.91 |
| IUPAC Name | 2-(4-bromophenyl)-N-[(E)-(2-hydroxy-5-iodophenyl)methylideneamino]acetamide |
| SMILES | O=C(Cc1ccc(Br)cc1)N/N=C/c1cc(I)ccc1O |
| InChI | InChI=1S/C15H12BrIN2O2/c16-12-3-1-10(2-4-12)7-15(21)19-18-9-11-8-13(17)5-6-14(11)20/h1-6,8-9,20H,7H2,(H,19,21)/b18-9+ |
| InChIKey | KEIGBAWUVVXBEF-GIJQJNRQSA-N |
| XLogP | 3.45 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.08 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|