C15H12Br2N4O3 — CID 136870132
1,3-bis[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]urea (PubChem CID 136870132) has the molecular formula C15H12Br2N4O3 and a molecular weight of 456.09 g/mol. Its IUPAC name is 1,3-bis[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]urea.
| Compound Name | 1,3-bis[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 136870132 |
| Molecular Formula | C15H12Br2N4O3 |
| Molecular Weight | 456.09 g/mol |
| Exact Mass | 453.93 |
| IUPAC Name | 1,3-bis[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]urea |
| SMILES | O=C(N/N=C\c1cc(Br)ccc1O)N/N=C\c1cc(Br)ccc1O |
| InChI | InChI=1S/C15H12Br2N4O3/c16-11-1-3-13(22)9(5-11)7-18-20-15(24)21-19-8-10-6-12(17)2-4-14(10)23/h1-8,22-23H,(H2,20,21,24)/b18-7-,19-8- |
| InChIKey | UXBYQJIQRYVDEN-DZWUWFSDSA-N |
| XLogP | 3.29 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.09 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|