C17H15BrN4O4 — CID 135606590
N-(4-acetamidophenyl)-N'-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]oxamide (PubChem CID 135606590) has the molecular formula C17H15BrN4O4 and a molecular weight of 419.24 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-N'-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]oxamide.
| Compound Name | N-(4-acetamidophenyl)-N'-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 135606590 |
| Molecular Formula | C17H15BrN4O4 |
| Molecular Weight | 419.24 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | N-(4-acetamidophenyl)-N'-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]oxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)C(=O)N/N=C/c2cc(Br)ccc2O)cc1 |
| InChI | InChI=1S/C17H15BrN4O4/c1-10(23)20-13-3-5-14(6-4-13)21-16(25)17(26)22-19-9-11-8-12(18)2-7-15(11)24/h2-9,24H,1H3,(H,20,23)(H,21,25)(H,22,26)/b19-9+ |
| InChIKey | UQIQIWJTXNJXSI-DJKKODMXSA-N |
| XLogP | 2.20 |
| TPSA | 119.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.24 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|