C15H10Br3N3O3 — CID 135554311
N-(4-bromophenyl)-N'-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]oxamide (PubChem CID 135554311) has the molecular formula C15H10Br3N3O3 and a molecular weight of 519.98 g/mol. Its IUPAC name is N-(4-bromophenyl)-N'-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]oxamide.
| Compound Name | N-(4-bromophenyl)-N'-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 135554311 |
| Molecular Formula | C15H10Br3N3O3 |
| Molecular Weight | 519.98 g/mol |
| Exact Mass | 516.83 |
| IUPAC Name | N-(4-bromophenyl)-N'-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]oxamide |
| SMILES | O=C(N/N=C/c1cc(Br)cc(Br)c1O)C(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H10Br3N3O3/c16-9-1-3-11(4-2-9)20-14(23)15(24)21-19-7-8-5-10(17)6-12(18)13(8)22/h1-7,22H,(H,20,23)(H,21,24)/b19-7+ |
| InChIKey | QZYYJPDZNJNUID-FBCYGCLPSA-N |
| XLogP | 3.77 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.98 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|