C21H20Br4N4O4 — CID 136802008
N,N'-bis[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]heptanediamide (PubChem CID 136802008) has the molecular formula C21H20Br4N4O4 and a molecular weight of 712.03 g/mol. Its IUPAC name is N,N'-bis[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]heptanediamide.
| Compound Name | N,N'-bis[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]heptanediamide |
|---|---|
| PubChem CID | 136802008 |
| Molecular Formula | C21H20Br4N4O4 |
| Molecular Weight | 712.03 g/mol |
| Exact Mass | 707.82 |
| IUPAC Name | N,N'-bis[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]heptanediamide |
| SMILES | O=C(CCCCCC(=O)N/N=C\c1cc(Br)cc(Br)c1O)N/N=C\c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C21H20Br4N4O4/c22-14-6-12(20(32)16(24)8-14)10-26-28-18(30)4-2-1-3-5-19(31)29-27-11-13-7-15(23)9-17(25)21(13)33/h6-11,32-33H,1-5H2,(H,28,30)(H,29,31)/b26-10-,27-11- |
| InChIKey | KLFBXZWKLHPKGJ-URLBMPHISA-N |
| XLogP | 5.70 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.03 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|