C13H10Br2N4O4 — CID 135683764
N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-(2,4-dioxo-1H-pyrimidin-6-yl)acetamide (PubChem CID 135683764) has the molecular formula C13H10Br2N4O4 and a molecular weight of 446.06 g/mol. Its IUPAC name is N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-(2,4-dioxo-1H-pyrimidin-6-yl)acetamide.
| Compound Name | N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-(2,4-dioxo-1H-pyrimidin-6-yl)acetamide |
|---|---|
| PubChem CID | 135683764 |
| Molecular Formula | C13H10Br2N4O4 |
| Molecular Weight | 446.06 g/mol |
| Exact Mass | 443.91 |
| IUPAC Name | N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-(2,4-dioxo-1H-pyrimidin-6-yl)acetamide |
| SMILES | O=C(Cc1cc(=O)[nH]c(=O)[nH]1)N/N=C/c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C13H10Br2N4O4/c14-7-1-6(12(22)9(15)2-7)5-16-19-11(21)4-8-3-10(20)18-13(23)17-8/h1-3,5,22H,4H2,(H,19,21)(H2,17,18,20,23)/b16-5+ |
| InChIKey | FCHAJNNAIASBBW-FZSIALSZSA-N |
| XLogP | 0.99 |
| TPSA | 127.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.06 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|