C21H17Br2N2O3P — CID 135425020
N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-diphenylphosphorylacetamide (PubChem CID 135425020) has the molecular formula C21H17Br2N2O3P and a molecular weight of 536.16 g/mol. Its IUPAC name is N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-diphenylphosphorylacetamide.
| Compound Name | N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-diphenylphosphorylacetamide |
|---|---|
| PubChem CID | 135425020 |
| Molecular Formula | C21H17Br2N2O3P |
| Molecular Weight | 536.16 g/mol |
| Exact Mass | 533.93 |
| IUPAC Name | N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-diphenylphosphorylacetamide |
| SMILES | O=C(CP(=O)(c1ccccc1)c1ccccc1)N/N=C/c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C21H17Br2N2O3P/c22-16-11-15(21(27)19(23)12-16)13-24-25-20(26)14-29(28,17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-13,27H,14H2,(H,25,26)/b24-13+ |
| InChIKey | LEVUGJCIFKFWLI-ZMOGYAJESA-N |
| XLogP | 4.38 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.16 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|