C22H17Br2N3O3 — CID 137062419
N-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-4-[(2-phenylacetyl)amino]benzamide (PubChem CID 137062419) has the molecular formula C22H17Br2N3O3 and a molecular weight of 531.20 g/mol. Its IUPAC name is N-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-4-[(2-phenylacetyl)amino]benzamide.
| Compound Name | N-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-4-[(2-phenylacetyl)amino]benzamide |
|---|---|
| PubChem CID | 137062419 |
| Molecular Formula | C22H17Br2N3O3 |
| Molecular Weight | 531.20 g/mol |
| Exact Mass | 528.96 |
| IUPAC Name | N-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-4-[(2-phenylacetyl)amino]benzamide |
| SMILES | O=C(Cc1ccccc1)Nc1ccc(C(=O)N/N=C\c2cc(Br)cc(Br)c2O)cc1 |
| InChI | InChI=1S/C22H17Br2N3O3/c23-17-11-16(21(29)19(24)12-17)13-25-27-22(30)15-6-8-18(9-7-15)26-20(28)10-14-4-2-1-3-5-14/h1-9,11-13,29H,10H2,(H,26,28)(H,27,30)/b25-13- |
| InChIKey | GOASNJYTTFCQJJ-MXAYSNPKSA-N |
| XLogP | 4.86 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.20 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|