C18H13Br2N3O2 — CID 5127516
N-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-4-pyrrol-1-ylbenzamide (PubChem CID 5127516) has the molecular formula C18H13Br2N3O2 and a molecular weight of 463.13 g/mol. Its IUPAC name is N-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-4-pyrrol-1-ylbenzamide.
| Compound Name | N-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-4-pyrrol-1-ylbenzamide |
|---|---|
| PubChem CID | 5127516 |
| Molecular Formula | C18H13Br2N3O2 |
| Molecular Weight | 463.13 g/mol |
| Exact Mass | 460.94 |
| IUPAC Name | N-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-4-pyrrol-1-ylbenzamide |
| SMILES | O=C(NN=Cc1cc(Br)cc(Br)c1O)c1ccc(-n2cccc2)cc1 |
| InChI | InChI=1S/C18H13Br2N3O2/c19-14-9-13(17(24)16(20)10-14)11-21-22-18(25)12-3-5-15(6-4-12)23-7-1-2-8-23/h1-11,24H,(H,22,25) |
| InChIKey | UCJJZEFZCDSNJW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 66.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.13 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|