C28H18Br4CuN4O4 — CID 24893930
copper;2-[(E)-(benzoylhydrazinylidene)methyl]-4,6-dibromophenolate;2-[(Z)-(benzoylhydrazinylidene)methyl]-4,6-dibromophenolate (PubChem CID 24893930) has the molecular formula C28H18Br4CuN4O4 and a molecular weight of 857.64 g/mol. Its IUPAC name is copper;2-[(E)-(benzoylhydrazinylidene)methyl]-4,6-dibromophenolate;2-[(Z)-(benzoylhydrazinylidene)methyl]-4,6-dibromophenolate.
| Compound Name | copper;2-[(E)-(benzoylhydrazinylidene)methyl]-4,6-dibromophenolate;2-[(Z)-(benzoylhydrazinylidene)methyl]-4,6-dibromophenolate |
|---|---|
| PubChem CID | 24893930 |
| Molecular Formula | C28H18Br4CuN4O4 |
| Molecular Weight | 857.64 g/mol |
| Exact Mass | 852.74 |
| IUPAC Name | copper;2-[(E)-(benzoylhydrazinylidene)methyl]-4,6-dibromophenolate;2-[(Z)-(benzoylhydrazinylidene)methyl]-4,6-dibromophenolate |
| SMILES | O=C(N/N=C/c1cc(Br)cc(Br)c1[O-])c1ccccc1.O=C(N/N=C/c1cc(Br)cc(Br)c1[O-])c1ccccc1.[Cu+2] |
| InChI | InChI=1S/2C14H10Br2N2O2.Cu/c2*15-11-6-10(13(19)12(16)7-11)8-17-18-14(20)9-4-2-1-3-5-9;/h2*1-8,19H,(H,18,20);/q;;+2/p-2/b2*17-8+; |
| InChIKey | JSBYBXNKVZVBEF-QZYMEUQESA-L |
| XLogP | 6.10 |
| TPSA | 129.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.64 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|