C21H13Br2Cl2N3O3 — CID 137173692
2,4-dichloro-N-[4-[[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide (PubChem CID 137173692) has the molecular formula C21H13Br2Cl2N3O3 and a molecular weight of 586.07 g/mol. Its IUPAC name is 2,4-dichloro-N-[4-[[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[4-[[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 137173692 |
| Molecular Formula | C21H13Br2Cl2N3O3 |
| Molecular Weight | 586.07 g/mol |
| Exact Mass | 582.87 |
| IUPAC Name | 2,4-dichloro-N-[4-[[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide |
| SMILES | O=C(N/N=C\c1cc(Br)cc(Br)c1O)c1ccc(NC(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C21H13Br2Cl2N3O3/c22-13-7-12(19(29)17(23)8-13)10-26-28-20(30)11-1-4-15(5-2-11)27-21(31)16-6-3-14(24)9-18(16)25/h1-10,29H,(H,27,31)(H,28,30)/b26-10- |
| InChIKey | UDZIIEUVJVUGQO-KALUYTGESA-N |
| XLogP | 6.24 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.07 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|