C17H10Br2Cl2N4O2 — CID 135842092
N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-(2,4-dichlorophenyl)-1H-pyrazole-5-carboxamide (PubChem CID 135842092) has the molecular formula C17H10Br2Cl2N4O2 and a molecular weight of 533.01 g/mol. Its IUPAC name is N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-(2,4-dichlorophenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-(2,4-dichlorophenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 135842092 |
| Molecular Formula | C17H10Br2Cl2N4O2 |
| Molecular Weight | 533.01 g/mol |
| Exact Mass | 529.85 |
| IUPAC Name | N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-(2,4-dichlorophenyl)-1H-pyrazole-5-carboxamide |
| SMILES | O=C(N/N=C/c1cc(Br)cc(Br)c1O)c1cc(-c2ccc(Cl)cc2Cl)n[nH]1 |
| InChI | InChI=1S/C17H10Br2Cl2N4O2/c18-9-3-8(16(26)12(19)4-9)7-22-25-17(27)15-6-14(23-24-15)11-2-1-10(20)5-13(11)21/h1-7,26H,(H,23,24)(H,25,27)/b22-7+ |
| InChIKey | QYVWQWBOYXLUQX-QPJQQBGISA-N |
| XLogP | 5.38 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.01 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|