C19H16Br2N4O2 — CID 135684320
N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-(3,4-dimethylphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 135684320) has the molecular formula C19H16Br2N4O2 and a molecular weight of 492.17 g/mol. Its IUPAC name is N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-(3,4-dimethylphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-(3,4-dimethylphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 135684320 |
| Molecular Formula | C19H16Br2N4O2 |
| Molecular Weight | 492.17 g/mol |
| Exact Mass | 489.96 |
| IUPAC Name | N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-3-(3,4-dimethylphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)N/N=C/c3cc(Br)cc(Br)c3O)[nH]n2)cc1C |
| InChI | InChI=1S/C19H16Br2N4O2/c1-10-3-4-12(5-11(10)2)16-8-17(24-23-16)19(27)25-22-9-13-6-14(20)7-15(21)18(13)26/h3-9,26H,1-2H3,(H,23,24)(H,25,27)/b22-9+ |
| InChIKey | MEOJICXUCGEDIF-LSFURLLWSA-N |
| XLogP | 4.69 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.17 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|