C27H34N4O2 — CID 2047519
N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-3-(3,4-dimethylphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 2047519) has the molecular formula C27H34N4O2 and a molecular weight of 446.60 g/mol. Its IUPAC name is N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-3-(3,4-dimethylphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-3-(3,4-dimethylphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 2047519 |
| Molecular Formula | C27H34N4O2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-3-(3,4-dimethylphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)NN=Cc3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)[nH]n2)cc1C |
| InChI | InChI=1S/C27H34N4O2/c1-16-9-10-19(11-17(16)2)22-14-23(30-29-22)25(33)31-28-15-18-12-20(26(3,4)5)24(32)21(13-18)27(6,7)8/h9-15,32H,1-8H3,(H,29,30)(H,31,33) |
| InChIKey | CJGKLBUEFMSUFB-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|