C17H15BrN4OS — CID 6891319
N-[(E)-(5-bromothiophen-2-yl)methylideneamino]-3-(3,4-dimethylphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 6891319) has the molecular formula C17H15BrN4OS and a molecular weight of 403.31 g/mol. Its IUPAC name is N-[(E)-(5-bromothiophen-2-yl)methylideneamino]-3-(3,4-dimethylphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(E)-(5-bromothiophen-2-yl)methylideneamino]-3-(3,4-dimethylphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 6891319 |
| Molecular Formula | C17H15BrN4OS |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | N-[(E)-(5-bromothiophen-2-yl)methylideneamino]-3-(3,4-dimethylphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)N/N=C/c3ccc(Br)s3)[nH]n2)cc1C |
| InChI | InChI=1S/C17H15BrN4OS/c1-10-3-4-12(7-11(10)2)14-8-15(21-20-14)17(23)22-19-9-13-5-6-16(18)24-13/h3-9H,1-2H3,(H,20,21)(H,22,23)/b19-9+ |
| InChIKey | SMCDCYUKRAGLNE-DJKKODMXSA-N |
| XLogP | 4.28 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|