C23H24N4O5 — CID 6891417
[4-[(E)-[[3-(3,4-dimethylphenyl)-1H-pyrazole-5-carbonyl]hydrazinylidene]methyl]-2,6-dimethoxyphenyl] acetate (PubChem CID 6891417) has the molecular formula C23H24N4O5 and a molecular weight of 436.47 g/mol. Its IUPAC name is [4-[(E)-[[3-(3,4-dimethylphenyl)-1H-pyrazole-5-carbonyl]hydrazinylidene]methyl]-2,6-dimethoxyphenyl] acetate.
| Compound Name | [4-[(E)-[[3-(3,4-dimethylphenyl)-1H-pyrazole-5-carbonyl]hydrazinylidene]methyl]-2,6-dimethoxyphenyl] acetate |
|---|---|
| PubChem CID | 6891417 |
| Molecular Formula | C23H24N4O5 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | [4-[(E)-[[3-(3,4-dimethylphenyl)-1H-pyrazole-5-carbonyl]hydrazinylidene]methyl]-2,6-dimethoxyphenyl] acetate |
| SMILES | COc1cc(/C=N/NC(=O)c2cc(-c3ccc(C)c(C)c3)n[nH]2)cc(OC)c1OC(C)=O |
| InChI | InChI=1S/C23H24N4O5/c1-13-6-7-17(8-14(13)2)18-11-19(26-25-18)23(29)27-24-12-16-9-20(30-4)22(32-15(3)28)21(10-16)31-5/h6-12H,1-5H3,(H,25,26)(H,27,29)/b24-12+ |
| InChIKey | JXNUYRFTGRWKBI-WYMPLXKRSA-N |
| XLogP | 3.40 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|