C19H16Cl2N4O — CID 6891233
N-[(E)-(2,6-dichlorophenyl)methylideneamino]-3-(3,4-dimethylphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 6891233) has the molecular formula C19H16Cl2N4O and a molecular weight of 387.27 g/mol. Its IUPAC name is N-[(E)-(2,6-dichlorophenyl)methylideneamino]-3-(3,4-dimethylphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(E)-(2,6-dichlorophenyl)methylideneamino]-3-(3,4-dimethylphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 6891233 |
| Molecular Formula | C19H16Cl2N4O |
| Molecular Weight | 387.27 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | N-[(E)-(2,6-dichlorophenyl)methylideneamino]-3-(3,4-dimethylphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)N/N=C/c3c(Cl)cccc3Cl)[nH]n2)cc1C |
| InChI | InChI=1S/C19H16Cl2N4O/c1-11-6-7-13(8-12(11)2)17-9-18(24-23-17)19(26)25-22-10-14-15(20)4-3-5-16(14)21/h3-10H,1-2H3,(H,23,24)(H,25,26)/b22-10+ |
| InChIKey | VKVKYFCRJBRQCQ-LSHDLFTRSA-N |
| XLogP | 4.76 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.27 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|