C22H18Cl2N6O — CID 6147438
N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-1H-pyrazole-5-carboxamide (PubChem CID 6147438) has the molecular formula C22H18Cl2N6O and a molecular weight of 453.33 g/mol. Its IUPAC name is N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 6147438 |
| Molecular Formula | C22H18Cl2N6O |
| Molecular Weight | 453.33 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-1H-pyrazole-5-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1-c1cc(C(=O)N/N=C\c2c(Cl)cccc2Cl)[nH]n1 |
| InChI | InChI=1S/C22H18Cl2N6O/c1-13-21(14(2)30(29-13)15-7-4-3-5-8-15)19-11-20(27-26-19)22(31)28-25-12-16-17(23)9-6-10-18(16)24/h3-12H,1-2H3,(H,26,27)(H,28,31)/b25-12- |
| InChIKey | YQVLXVZVLFEDCT-ROTLSHHCSA-N |
| XLogP | 4.95 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.33 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|