C28H24N6O — CID 6105907
N-[(Z)-(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-3-(4-phenylphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 6105907) has the molecular formula C28H24N6O and a molecular weight of 460.54 g/mol. Its IUPAC name is N-[(Z)-(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-3-(4-phenylphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(Z)-(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-3-(4-phenylphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 6105907 |
| Molecular Formula | C28H24N6O |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | N-[(Z)-(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-3-(4-phenylphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1/C=N\NC(=O)c1cc(-c2ccc(-c3ccccc3)cc2)n[nH]1 |
| InChI | InChI=1S/C28H24N6O/c1-19-25(20(2)34(33-19)24-11-7-4-8-12-24)18-29-32-28(35)27-17-26(30-31-27)23-15-13-22(14-16-23)21-9-5-3-6-10-21/h3-18H,1-2H3,(H,30,31)(H,32,35)/b29-18- |
| InChIKey | FSRSRTZOHCYAMF-MIXAMLLLSA-N |
| XLogP | 5.31 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|