C28H23N5O — CID 4504163
N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-2-phenylquinoline-4-carboxamide (PubChem CID 4504163) has the molecular formula C28H23N5O and a molecular weight of 445.53 g/mol. Its IUPAC name is N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 4504163 |
| Molecular Formula | C28H23N5O |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-2-phenylquinoline-4-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C=NNC(=O)c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C28H23N5O/c1-19-25(20(2)33(32-19)22-13-7-4-8-14-22)18-29-31-28(34)24-17-27(21-11-5-3-6-12-21)30-26-16-10-9-15-23(24)26/h3-18H,1-2H3,(H,31,34) |
| InChIKey | XVTFQLZUFANVLJ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|