C30H26ClN5O4 — CID 6900372
N-[(E)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide (PubChem CID 6900372) has the molecular formula C30H26ClN5O4 and a molecular weight of 556.02 g/mol. Its IUPAC name is N-[(E)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide.
| Compound Name | N-[(E)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 6900372 |
| Molecular Formula | C30H26ClN5O4 |
| Molecular Weight | 556.02 g/mol |
| Exact Mass | 555.17 |
| IUPAC Name | N-[(E)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide |
| SMILES | COc1cc(-c2cc(C(=O)N/N=C/c3c(C)nn(-c4ccccc4)c3Cl)c3ccccc3n2)cc(OC)c1OC |
| InChI | InChI=1S/C30H26ClN5O4/c1-18-23(29(31)36(35-18)20-10-6-5-7-11-20)17-32-34-30(37)22-16-25(33-24-13-9-8-12-21(22)24)19-14-26(38-2)28(40-4)27(15-19)39-3/h5-17H,1-4H3,(H,34,37)/b32-17+ |
| InChIKey | FMDBDFPOBMHRSU-VTNSRFBWSA-N |
| XLogP | 5.84 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.02 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|