C28H26N4O5 — CID 42991259
N-[(E)-(4-acetamidophenyl)methylideneamino]-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide (PubChem CID 42991259) has the molecular formula C28H26N4O5 and a molecular weight of 498.54 g/mol. Its IUPAC name is N-[(E)-(4-acetamidophenyl)methylideneamino]-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide.
| Compound Name | N-[(E)-(4-acetamidophenyl)methylideneamino]-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 42991259 |
| Molecular Formula | C28H26N4O5 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | N-[(E)-(4-acetamidophenyl)methylideneamino]-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide |
| SMILES | COc1cc(-c2cc(C(=O)N/N=C/c3ccc(NC(C)=O)cc3)c3ccccc3n2)cc(OC)c1OC |
| InChI | InChI=1S/C28H26N4O5/c1-17(33)30-20-11-9-18(10-12-20)16-29-32-28(34)22-15-24(31-23-8-6-5-7-21(22)23)19-13-25(35-2)27(37-4)26(14-19)36-3/h5-16H,1-4H3,(H,30,33)(H,32,34)/b29-16+ |
| InChIKey | UNYBOKSUSNMGHM-MUFRIFMGSA-N |
| XLogP | 4.65 |
| TPSA | 111.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|