C20H16ClN5O — CID 8901554
N-[(Z)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-1H-indole-3-carboxamide (PubChem CID 8901554) has the molecular formula C20H16ClN5O and a molecular weight of 377.84 g/mol. Its IUPAC name is N-[(Z)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-1H-indole-3-carboxamide.
| Compound Name | N-[(Z)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 8901554 |
| Molecular Formula | C20H16ClN5O |
| Molecular Weight | 377.84 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | N-[(Z)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-1H-indole-3-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1/C=N\NC(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H16ClN5O/c1-13-16(19(21)26(25-13)14-7-3-2-4-8-14)12-23-24-20(27)17-11-22-18-10-6-5-9-15(17)18/h2-12,22H,1H3,(H,24,27)/b23-12- |
| InChIKey | BKQLZGDSDVMZKR-FMCGGJTJSA-N |
| XLogP | 4.08 |
| TPSA | 75.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.84 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|